C23H23FN2O2S — CID 30135373
(4S)-N-(4-fluorophenyl)-2,7,7-trimethyl-5-oxo-4-thiophen-3-yl-1,4,6,8-tetrahydroquinoline-3-carboxamide (PubChem CID 30135373) has the molecular formula C23H23FN2O2S and a molecular weight of 410.51 g/mol. Its IUPAC name is (4S)-N-(4-fluorophenyl)-2,7,7-trimethyl-5-oxo-4-thiophen-3-yl-1,4,6,8-tetrahydroquinoline-3-carboxamide.
| Compound Name | (4S)-N-(4-fluorophenyl)-2,7,7-trimethyl-5-oxo-4-thiophen-3-yl-1,4,6,8-tetrahydroquinoline-3-carboxamide |
|---|---|
| PubChem CID | 30135373 |
| Molecular Formula | C23H23FN2O2S |
| Molecular Weight | 410.51 g/mol |
| Exact Mass | 410.15 |
| IUPAC Name | (4S)-N-(4-fluorophenyl)-2,7,7-trimethyl-5-oxo-4-thiophen-3-yl-1,4,6,8-tetrahydroquinoline-3-carboxamide |
| SMILES | CC1=C(C(=O)Nc2ccc(F)cc2)[C@@H](c2ccsc2)C2=C(CC(C)(C)CC2=O)N1 |
| InChI | InChI=1S/C23H23FN2O2S/c1-13-19(22(28)26-16-6-4-15(24)5-7-16)20(14-8-9-29-12-14)21-17(25-13)10-23(2,3)11-18(21)27/h4-9,12,20,25H,10-11H2,1-3H3,(H,26,28)/t20-/m1/s1 |
| InChIKey | LHYRKZWPBIMOLJ-HXUWFJFHSA-N |
| XLogP | 5.13 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.51 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |