C21H12N4O3S — CID 139030803
4-(9,13-dioxo-15-sulfanylidene-8-oxa-14,16,18-triazatetracyclo[8.8.0.02,7.012,17]octadeca-1(10),2,4,6,12(17)-pentaen-11-yl)benzonitrile (PubChem CID 139030803) has the molecular formula C21H12N4O3S and a molecular weight of 400.42 g/mol. Its IUPAC name is 4-(9,13-dioxo-15-sulfanylidene-8-oxa-14,16,18-triazatetracyclo[8.8.0.02,7.012,17]octadeca-1(10),2,4,6,12(17)-pentaen-11-yl)benzonitrile.
| Compound Name | 4-(9,13-dioxo-15-sulfanylidene-8-oxa-14,16,18-triazatetracyclo[8.8.0.02,7.012,17]octadeca-1(10),2,4,6,12(17)-pentaen-11-yl)benzonitrile |
|---|---|
| PubChem CID | 139030803 |
| Molecular Formula | C21H12N4O3S |
| Molecular Weight | 400.42 g/mol |
| Exact Mass | 400.06 |
| IUPAC Name | 4-(9,13-dioxo-15-sulfanylidene-8-oxa-14,16,18-triazatetracyclo[8.8.0.02,7.012,17]octadeca-1(10),2,4,6,12(17)-pentaen-11-yl)benzonitrile |
| SMILES | N#Cc1ccc(C2c3c([nH]c(=S)[nH]c3=O)Nc3c2c(=O)oc2ccccc32)cc1 |
| InChI | InChI=1S/C21H12N4O3S/c22-9-10-5-7-11(8-6-10)14-15-17(12-3-1-2-4-13(12)28-20(15)27)23-18-16(14)19(26)25-21(29)24-18/h1-8,14H,(H3,23,24,25,26,29) |
| InChIKey | ZBPIIMHTWNSJIW-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 114.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.42 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|