C20H12ClN3O3S — CID 139030793
11-(3-chlorophenyl)-15-sulfanylidene-8-oxa-14,16,18-triazatetracyclo[8.8.0.02,7.012,17]octadeca-1(10),2,4,6,12(17)-pentaene-9,13-dione (PubChem CID 139030793) has the molecular formula C20H12ClN3O3S and a molecular weight of 409.85 g/mol. Its IUPAC name is 11-(3-chlorophenyl)-15-sulfanylidene-8-oxa-14,16,18-triazatetracyclo[8.8.0.02,7.012,17]octadeca-1(10),2,4,6,12(17)-pentaene-9,13-dione.
| Compound Name | 11-(3-chlorophenyl)-15-sulfanylidene-8-oxa-14,16,18-triazatetracyclo[8.8.0.02,7.012,17]octadeca-1(10),2,4,6,12(17)-pentaene-9,13-dione |
|---|---|
| PubChem CID | 139030793 |
| Molecular Formula | C20H12ClN3O3S |
| Molecular Weight | 409.85 g/mol |
| Exact Mass | 409.03 |
| IUPAC Name | 11-(3-chlorophenyl)-15-sulfanylidene-8-oxa-14,16,18-triazatetracyclo[8.8.0.02,7.012,17]octadeca-1(10),2,4,6,12(17)-pentaene-9,13-dione |
| SMILES | O=c1[nH]c(=S)[nH]c2c1C(c1cccc(Cl)c1)c1c(c3ccccc3oc1=O)N2 |
| InChI | InChI=1S/C20H12ClN3O3S/c21-10-5-3-4-9(8-10)13-14-16(11-6-1-2-7-12(11)27-19(14)26)22-17-15(13)18(25)24-20(28)23-17/h1-8,13H,(H3,22,23,24,25,28) |
| InChIKey | RQHQGXXFJFLMAS-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 90.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.85 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|