C21H16ClN5OS — CID 137250235
8-(3-chlorophenyl)-6-methyl-4-phenyl-12-sulfanylidene-2,4,5,11,13-pentazatricyclo[7.4.0.03,7]trideca-1(9),3(7),5-trien-10-one (PubChem CID 137250235) has the molecular formula C21H16ClN5OS and a molecular weight of 421.91 g/mol. Its IUPAC name is 8-(3-chlorophenyl)-6-methyl-4-phenyl-12-sulfanylidene-2,4,5,11,13-pentazatricyclo[7.4.0.03,7]trideca-1(9),3(7),5-trien-10-one.
| Compound Name | 8-(3-chlorophenyl)-6-methyl-4-phenyl-12-sulfanylidene-2,4,5,11,13-pentazatricyclo[7.4.0.03,7]trideca-1(9),3(7),5-trien-10-one |
|---|---|
| PubChem CID | 137250235 |
| Molecular Formula | C21H16ClN5OS |
| Molecular Weight | 421.91 g/mol |
| Exact Mass | 421.08 |
| IUPAC Name | 8-(3-chlorophenyl)-6-methyl-4-phenyl-12-sulfanylidene-2,4,5,11,13-pentazatricyclo[7.4.0.03,7]trideca-1(9),3(7),5-trien-10-one |
| SMILES | Cc1nn(-c2ccccc2)c2c1C(c1cccc(Cl)c1)c1c([nH]c(=S)[nH]c1=O)N2 |
| InChI | InChI=1S/C21H16ClN5OS/c1-11-15-16(12-6-5-7-13(22)10-12)17-18(24-21(29)25-20(17)28)23-19(15)27(26-11)14-8-3-2-4-9-14/h2-10,16H,1H3,(H3,23,24,25,28,29) |
| InChIKey | FNXQJPIYRRLSJJ-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 78.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.91 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|