C22H17N5O2 — CID 137250297
3-methyl-4-(3-nitrophenyl)-1-phenyl-4,9-dihydropyrazolo[5,4-b][1,8]naphthyridine (PubChem CID 137250297) has the molecular formula C22H17N5O2 and a molecular weight of 383.41 g/mol. Its IUPAC name is 3-methyl-4-(3-nitrophenyl)-1-phenyl-4,9-dihydropyrazolo[5,4-b][1,8]naphthyridine.
| Compound Name | 3-methyl-4-(3-nitrophenyl)-1-phenyl-4,9-dihydropyrazolo[5,4-b][1,8]naphthyridine |
|---|---|
| PubChem CID | 137250297 |
| Molecular Formula | C22H17N5O2 |
| Molecular Weight | 383.41 g/mol |
| Exact Mass | 383.14 |
| IUPAC Name | 3-methyl-4-(3-nitrophenyl)-1-phenyl-4,9-dihydropyrazolo[5,4-b][1,8]naphthyridine |
| SMILES | Cc1nn(-c2ccccc2)c2c1C(c1cccc([N+](=O)[O-])c1)c1cccnc1N2 |
| InChI | InChI=1S/C22H17N5O2/c1-14-19-20(15-7-5-10-17(13-15)27(28)29)18-11-6-12-23-21(18)24-22(19)26(25-14)16-8-3-2-4-9-16/h2-13,20H,1H3,(H,23,24) |
| InChIKey | YNQNNIFPQLCBEX-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 85.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.41 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|