C25H20FN5O2 — CID 2455127
(4S)-6-(2-fluorophenyl)-3,5-dimethyl-4-(3-nitrophenyl)-1-phenyl-4H-pyrazolo[5,4-d]pyrimidine (PubChem CID 2455127) has the molecular formula C25H20FN5O2 and a molecular weight of 441.47 g/mol. Its IUPAC name is (4S)-6-(2-fluorophenyl)-3,5-dimethyl-4-(3-nitrophenyl)-1-phenyl-4H-pyrazolo[5,4-d]pyrimidine.
| Compound Name | (4S)-6-(2-fluorophenyl)-3,5-dimethyl-4-(3-nitrophenyl)-1-phenyl-4H-pyrazolo[5,4-d]pyrimidine |
|---|---|
| PubChem CID | 2455127 |
| Molecular Formula | C25H20FN5O2 |
| Molecular Weight | 441.47 g/mol |
| Exact Mass | 441.16 |
| IUPAC Name | (4S)-6-(2-fluorophenyl)-3,5-dimethyl-4-(3-nitrophenyl)-1-phenyl-4H-pyrazolo[5,4-d]pyrimidine |
| SMILES | Cc1nn(-c2ccccc2)c2c1[C@H](c1cccc([N+](=O)[O-])c1)N(C)C(c1ccccc1F)=N2 |
| InChI | InChI=1S/C25H20FN5O2/c1-16-22-23(17-9-8-12-19(15-17)31(32)33)29(2)24(20-13-6-7-14-21(20)26)27-25(22)30(28-16)18-10-4-3-5-11-18/h3-15,23H,1-2H3/t23-/m0/s1 |
| InChIKey | YQMOFKKSYSTBKP-QHCPKHFHSA-N |
| XLogP | 5.34 |
| TPSA | 76.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.47 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|