C31H24N8O3 — CID 3949364
N-(3-methoxyphenyl)-15-methyl-17-(3-nitrophenyl)-13-pyridin-2-yl-1,8,11,13,14-pentazatetracyclo[8.7.0.02,7.012,16]heptadeca-2,4,6,8,10,12(16),14-heptaen-9-amine (PubChem CID 3949364) has the molecular formula C31H24N8O3 and a molecular weight of 556.59 g/mol. Its IUPAC name is N-(3-methoxyphenyl)-15-methyl-17-(3-nitrophenyl)-13-pyridin-2-yl-1,8,11,13,14-pentazatetracyclo[8.7.0.02,7.012,16]heptadeca-2,4,6,8,10,12(16),14-heptaen-9-amine.
| Compound Name | N-(3-methoxyphenyl)-15-methyl-17-(3-nitrophenyl)-13-pyridin-2-yl-1,8,11,13,14-pentazatetracyclo[8.7.0.02,7.012,16]heptadeca-2,4,6,8,10,12(16),14-heptaen-9-amine |
|---|---|
| PubChem CID | 3949364 |
| Molecular Formula | C31H24N8O3 |
| Molecular Weight | 556.59 g/mol |
| Exact Mass | 556.20 |
| IUPAC Name | N-(3-methoxyphenyl)-15-methyl-17-(3-nitrophenyl)-13-pyridin-2-yl-1,8,11,13,14-pentazatetracyclo[8.7.0.02,7.012,16]heptadeca-2,4,6,8,10,12(16),14-heptaen-9-amine |
| SMILES | COc1cccc(NC2=Nc3ccccc3N3C2=Nc2c(c(C)nn2-c2ccccn2)C3c2cccc([N+](=O)[O-])c2)c1 |
| InChI | InChI=1S/C31H24N8O3/c1-19-27-28(20-9-7-11-22(17-20)39(40)41)37-25-14-4-3-13-24(25)34-29(33-21-10-8-12-23(18-21)42-2)31(37)35-30(27)38(36-19)26-15-5-6-16-32-26/h3-18,28H,1-2H3,(H,33,34) |
| InChIKey | AHHQFPRHVQDPTB-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 123.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.59 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|