C32H26N6O — CID 5183560
N-(3-methoxyphenyl)-15-methyl-13,17-diphenyl-1,8,11,13,14-pentazatetracyclo[8.7.0.02,7.012,16]heptadeca-2,4,6,8,10,12(16),14-heptaen-9-amine (PubChem CID 5183560) has the molecular formula C32H26N6O and a molecular weight of 510.60 g/mol. Its IUPAC name is N-(3-methoxyphenyl)-15-methyl-13,17-diphenyl-1,8,11,13,14-pentazatetracyclo[8.7.0.02,7.012,16]heptadeca-2,4,6,8,10,12(16),14-heptaen-9-amine.
| Compound Name | N-(3-methoxyphenyl)-15-methyl-13,17-diphenyl-1,8,11,13,14-pentazatetracyclo[8.7.0.02,7.012,16]heptadeca-2,4,6,8,10,12(16),14-heptaen-9-amine |
|---|---|
| PubChem CID | 5183560 |
| Molecular Formula | C32H26N6O |
| Molecular Weight | 510.60 g/mol |
| Exact Mass | 510.22 |
| IUPAC Name | N-(3-methoxyphenyl)-15-methyl-13,17-diphenyl-1,8,11,13,14-pentazatetracyclo[8.7.0.02,7.012,16]heptadeca-2,4,6,8,10,12(16),14-heptaen-9-amine |
| SMILES | COc1cccc(NC2=Nc3ccccc3N3C2=Nc2c(c(C)nn2-c2ccccc2)C3c2ccccc2)c1 |
| InChI | InChI=1S/C32H26N6O/c1-21-28-29(22-12-5-3-6-13-22)37-27-19-10-9-18-26(27)34-30(33-23-14-11-17-25(20-23)39-2)32(37)35-31(28)38(36-21)24-15-7-4-8-16-24/h3-20,29H,1-2H3,(H,33,34) |
| InChIKey | PXHZWVJIFLCTGW-UHFFFAOYSA-N |
| XLogP | 6.98 |
| TPSA | 67.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.60 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |