C35H32N6O — CID 98310850
(17S)-N-(4-butoxyphenyl)-15-methyl-13,17-diphenyl-1,8,11,13,14-pentazatetracyclo[8.7.0.02,7.012,16]heptadeca-2,4,6,8,10,12(16),14-heptaen-9-amine (PubChem CID 98310850) has the molecular formula C35H32N6O and a molecular weight of 552.68 g/mol. Its IUPAC name is (17S)-N-(4-butoxyphenyl)-15-methyl-13,17-diphenyl-1,8,11,13,14-pentazatetracyclo[8.7.0.02,7.012,16]heptadeca-2,4,6,8,10,12(16),14-heptaen-9-amine.
| Compound Name | (17S)-N-(4-butoxyphenyl)-15-methyl-13,17-diphenyl-1,8,11,13,14-pentazatetracyclo[8.7.0.02,7.012,16]heptadeca-2,4,6,8,10,12(16),14-heptaen-9-amine |
|---|---|
| PubChem CID | 98310850 |
| Molecular Formula | C35H32N6O |
| Molecular Weight | 552.68 g/mol |
| Exact Mass | 552.26 |
| IUPAC Name | (17S)-N-(4-butoxyphenyl)-15-methyl-13,17-diphenyl-1,8,11,13,14-pentazatetracyclo[8.7.0.02,7.012,16]heptadeca-2,4,6,8,10,12(16),14-heptaen-9-amine |
| SMILES | CCCCOc1ccc(NC2=Nc3ccccc3N3C2=Nc2c(c(C)nn2-c2ccccc2)[C@@H]3c2ccccc2)cc1 |
| InChI | InChI=1S/C35H32N6O/c1-3-4-23-42-28-21-19-26(20-22-28)36-33-35-38-34-31(24(2)39-41(34)27-15-9-6-10-16-27)32(25-13-7-5-8-14-25)40(35)30-18-12-11-17-29(30)37-33/h5-22,32H,3-4,23H2,1-2H3,(H,36,37)/t32-/m0/s1 |
| InChIKey | ARSHEVCALOQKGV-YTTGMZPUSA-N |
| XLogP | 8.15 |
| TPSA | 67.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.68 |
| LogP ≤ 5 | 8.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|