C31H24N6 — CID 3803298
15-methyl-N,13,17-triphenyl-1,8,11,13,14-pentazatetracyclo[8.7.0.02,7.012,16]heptadeca-2,4,6,8,10,12(16),14-heptaen-9-amine (PubChem CID 3803298) has the molecular formula C31H24N6 and a molecular weight of 480.58 g/mol. Its IUPAC name is 15-methyl-N,13,17-triphenyl-1,8,11,13,14-pentazatetracyclo[8.7.0.02,7.012,16]heptadeca-2,4,6,8,10,12(16),14-heptaen-9-amine.
| Compound Name | 15-methyl-N,13,17-triphenyl-1,8,11,13,14-pentazatetracyclo[8.7.0.02,7.012,16]heptadeca-2,4,6,8,10,12(16),14-heptaen-9-amine |
|---|---|
| PubChem CID | 3803298 |
| Molecular Formula | C31H24N6 |
| Molecular Weight | 480.58 g/mol |
| Exact Mass | 480.21 |
| IUPAC Name | 15-methyl-N,13,17-triphenyl-1,8,11,13,14-pentazatetracyclo[8.7.0.02,7.012,16]heptadeca-2,4,6,8,10,12(16),14-heptaen-9-amine |
| SMILES | Cc1nn(-c2ccccc2)c2c1C(c1ccccc1)N1C(=N2)C(Nc2ccccc2)=Nc2ccccc21 |
| InChI | InChI=1S/C31H24N6/c1-21-27-28(22-13-5-2-6-14-22)36-26-20-12-11-19-25(26)33-29(32-23-15-7-3-8-16-23)31(36)34-30(27)37(35-21)24-17-9-4-10-18-24/h2-20,28H,1H3,(H,32,33) |
| InChIKey | ZNUWKICUNOTMJD-UHFFFAOYSA-N |
| XLogP | 6.98 |
| TPSA | 57.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.58 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |