C25H18N6O3 — CID 3273364
15-methyl-17-(3-nitrophenyl)-13-phenyl-1,8,11,13,14-pentazatetracyclo[8.7.0.02,7.012,16]heptadeca-2,4,6,10,12(16),14-hexaen-9-one (PubChem CID 3273364) has the molecular formula C25H18N6O3 and a molecular weight of 450.46 g/mol. Its IUPAC name is 15-methyl-17-(3-nitrophenyl)-13-phenyl-1,8,11,13,14-pentazatetracyclo[8.7.0.02,7.012,16]heptadeca-2,4,6,10,12(16),14-hexaen-9-one.
| Compound Name | 15-methyl-17-(3-nitrophenyl)-13-phenyl-1,8,11,13,14-pentazatetracyclo[8.7.0.02,7.012,16]heptadeca-2,4,6,10,12(16),14-hexaen-9-one |
|---|---|
| PubChem CID | 3273364 |
| Molecular Formula | C25H18N6O3 |
| Molecular Weight | 450.46 g/mol |
| Exact Mass | 450.14 |
| IUPAC Name | 15-methyl-17-(3-nitrophenyl)-13-phenyl-1,8,11,13,14-pentazatetracyclo[8.7.0.02,7.012,16]heptadeca-2,4,6,10,12(16),14-hexaen-9-one |
| SMILES | Cc1nn(-c2ccccc2)c2c1C(c1cccc([N+](=O)[O-])c1)N1C(=N2)C(=O)Nc2ccccc21 |
| InChI | InChI=1S/C25H18N6O3/c1-15-21-22(16-8-7-11-18(14-16)31(33)34)29-20-13-6-5-12-19(20)26-25(32)24(29)27-23(21)30(28-15)17-9-3-2-4-10-17/h2-14,22H,1H3,(H,26,32) |
| InChIKey | UNPMOTMVOIBGCM-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 105.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.46 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|