C34H28N6O7S — CID 4103626
[2-methoxy-4-[15-methyl-13-(4-nitrophenyl)-9-oxo-1,8,11,13,14-pentazatetracyclo[8.7.0.02,7.012,16]heptadeca-2,4,6,10,12(16),14-hexaen-17-yl]phenyl] 2,5-dimethylbenzenesulfonate (PubChem CID 4103626) has the molecular formula C34H28N6O7S and a molecular weight of 664.70 g/mol. Its IUPAC name is [2-methoxy-4-[15-methyl-13-(4-nitrophenyl)-9-oxo-1,8,11,13,14-pentazatetracyclo[8.7.0.02,7.012,16]heptadeca-2,4,6,10,12(16),14-hexaen-17-yl]phenyl] 2,5-dimethylbenzenesulfonate.
| Compound Name | [2-methoxy-4-[15-methyl-13-(4-nitrophenyl)-9-oxo-1,8,11,13,14-pentazatetracyclo[8.7.0.02,7.012,16]heptadeca-2,4,6,10,12(16),14-hexaen-17-yl]phenyl] 2,5-dimethylbenzenesulfonate |
|---|---|
| PubChem CID | 4103626 |
| Molecular Formula | C34H28N6O7S |
| Molecular Weight | 664.70 g/mol |
| Exact Mass | 664.17 |
| IUPAC Name | [2-methoxy-4-[15-methyl-13-(4-nitrophenyl)-9-oxo-1,8,11,13,14-pentazatetracyclo[8.7.0.02,7.012,16]heptadeca-2,4,6,10,12(16),14-hexaen-17-yl]phenyl] 2,5-dimethylbenzenesulfonate |
| SMILES | COc1cc(C2c3c(C)nn(-c4ccc([N+](=O)[O-])cc4)c3N=C3C(=O)Nc4ccccc4N32)ccc1OS(=O)(=O)c1cc(C)ccc1C |
| InChI | InChI=1S/C34H28N6O7S/c1-19-9-10-20(2)29(17-19)48(44,45)47-27-16-11-22(18-28(27)46-4)31-30-21(3)37-39(23-12-14-24(15-13-23)40(42)43)32(30)36-33-34(41)35-25-7-5-6-8-26(25)38(31)33/h5-18,31H,1-4H3,(H,35,41) |
| InChIKey | QQNJPDOGIDYWEW-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 158.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 48 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.70 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|