C25H16ClN7O5 — CID 2425580
(17R)-17-(4-chloro-3-nitrophenyl)-15-methyl-13-(4-nitrophenyl)-1,8,11,13,14-pentazatetracyclo[8.7.0.02,7.012,16]heptadeca-2,4,6,10,12(16),14-hexaen-9-one (PubChem CID 2425580) has the molecular formula C25H16ClN7O5 and a molecular weight of 529.90 g/mol. Its IUPAC name is (17R)-17-(4-chloro-3-nitrophenyl)-15-methyl-13-(4-nitrophenyl)-1,8,11,13,14-pentazatetracyclo[8.7.0.02,7.012,16]heptadeca-2,4,6,10,12(16),14-hexaen-9-one.
| Compound Name | (17R)-17-(4-chloro-3-nitrophenyl)-15-methyl-13-(4-nitrophenyl)-1,8,11,13,14-pentazatetracyclo[8.7.0.02,7.012,16]heptadeca-2,4,6,10,12(16),14-hexaen-9-one |
|---|---|
| PubChem CID | 2425580 |
| Molecular Formula | C25H16ClN7O5 |
| Molecular Weight | 529.90 g/mol |
| Exact Mass | 529.09 |
| IUPAC Name | (17R)-17-(4-chloro-3-nitrophenyl)-15-methyl-13-(4-nitrophenyl)-1,8,11,13,14-pentazatetracyclo[8.7.0.02,7.012,16]heptadeca-2,4,6,10,12(16),14-hexaen-9-one |
| SMILES | Cc1nn(-c2ccc([N+](=O)[O-])cc2)c2c1[C@@H](c1ccc(Cl)c([N+](=O)[O-])c1)N1C(=N2)C(=O)Nc2ccccc21 |
| InChI | InChI=1S/C25H16ClN7O5/c1-13-21-22(14-6-11-17(26)20(12-14)33(37)38)30-19-5-3-2-4-18(19)27-25(34)24(30)28-23(21)31(29-13)15-7-9-16(10-8-15)32(35)36/h2-12,22H,1H3,(H,27,34)/t22-/m1/s1 |
| InChIKey | WOQYPCIIOQJOBV-JOCHJYFZSA-N |
| XLogP | 5.24 |
| TPSA | 148.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.90 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|