C33H28N6 — CID 135976696
(17S)-N-(2,3-dimethylphenyl)-15-methyl-13,17-diphenyl-1,8,11,13,14-pentazatetracyclo[8.7.0.02,7.012,16]heptadeca-2,4,6,10,12(16),14-hexaen-9-imine (PubChem CID 135976696) has the molecular formula C33H28N6 and a molecular weight of 508.63 g/mol. Its IUPAC name is (17S)-N-(2,3-dimethylphenyl)-15-methyl-13,17-diphenyl-1,8,11,13,14-pentazatetracyclo[8.7.0.02,7.012,16]heptadeca-2,4,6,10,12(16),14-hexaen-9-imine.
| Compound Name | (17S)-N-(2,3-dimethylphenyl)-15-methyl-13,17-diphenyl-1,8,11,13,14-pentazatetracyclo[8.7.0.02,7.012,16]heptadeca-2,4,6,10,12(16),14-hexaen-9-imine |
|---|---|
| PubChem CID | 135976696 |
| Molecular Formula | C33H28N6 |
| Molecular Weight | 508.63 g/mol |
| Exact Mass | 508.24 |
| IUPAC Name | (17S)-N-(2,3-dimethylphenyl)-15-methyl-13,17-diphenyl-1,8,11,13,14-pentazatetracyclo[8.7.0.02,7.012,16]heptadeca-2,4,6,10,12(16),14-hexaen-9-imine |
| SMILES | Cc1cccc(/N=C2\Nc3ccccc3N3C2=Nc2c(c(C)nn2-c2ccccc2)[C@@H]3c2ccccc2)c1C |
| InChI | InChI=1S/C33H28N6/c1-21-13-12-19-26(22(21)2)34-31-33-36-32-29(23(3)37-39(32)25-16-8-5-9-17-25)30(24-14-6-4-7-15-24)38(33)28-20-11-10-18-27(28)35-31/h4-20,30H,1-3H3,(H,34,35)/t30-/m0/s1 |
| InChIKey | INYPDIDYTKXVDI-PMERELPUSA-N |
| XLogP | 7.59 |
| TPSA | 57.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.63 |
| LogP ≤ 5 | 7.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|