C35H32N6 — CID 136792686
(17S)-15-methyl-N-(2-methylphenyl)-13-phenyl-17-(4-propan-2-ylphenyl)-1,8,11,13,14-pentazatetracyclo[8.7.0.02,7.012,16]heptadeca-2,4,6,10,12(16),14-hexaen-9-imine (PubChem CID 136792686) has the molecular formula C35H32N6 and a molecular weight of 536.68 g/mol. Its IUPAC name is (17S)-15-methyl-N-(2-methylphenyl)-13-phenyl-17-(4-propan-2-ylphenyl)-1,8,11,13,14-pentazatetracyclo[8.7.0.02,7.012,16]heptadeca-2,4,6,10,12(16),14-hexaen-9-imine.
| Compound Name | (17S)-15-methyl-N-(2-methylphenyl)-13-phenyl-17-(4-propan-2-ylphenyl)-1,8,11,13,14-pentazatetracyclo[8.7.0.02,7.012,16]heptadeca-2,4,6,10,12(16),14-hexaen-9-imine |
|---|---|
| PubChem CID | 136792686 |
| Molecular Formula | C35H32N6 |
| Molecular Weight | 536.68 g/mol |
| Exact Mass | 536.27 |
| IUPAC Name | (17S)-15-methyl-N-(2-methylphenyl)-13-phenyl-17-(4-propan-2-ylphenyl)-1,8,11,13,14-pentazatetracyclo[8.7.0.02,7.012,16]heptadeca-2,4,6,10,12(16),14-hexaen-9-imine |
| SMILES | Cc1ccccc1/N=C1\Nc2ccccc2N2C1=Nc1c(c(C)nn1-c1ccccc1)[C@@H]2c1ccc(C(C)C)cc1 |
| InChI | InChI=1S/C35H32N6/c1-22(2)25-18-20-26(21-19-25)32-31-24(4)39-41(27-13-6-5-7-14-27)34(31)38-35-33(36-28-15-9-8-12-23(28)3)37-29-16-10-11-17-30(29)40(32)35/h5-22,32H,1-4H3,(H,36,37)/t32-/m0/s1 |
| InChIKey | CGIABUXSABCFFH-YTTGMZPUSA-N |
| XLogP | 8.41 |
| TPSA | 57.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.68 |
| LogP ≤ 5 | 8.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|