C33H27FN6 — CID 135497782
N-(2,3-dimethylphenyl)-17-(2-fluorophenyl)-15-methyl-13-phenyl-1,8,11,13,14-pentazatetracyclo[8.7.0.02,7.012,16]heptadeca-2,4,6,10,12(16),14-hexaen-9-imine (PubChem CID 135497782) has the molecular formula C33H27FN6 and a molecular weight of 526.62 g/mol. Its IUPAC name is N-(2,3-dimethylphenyl)-17-(2-fluorophenyl)-15-methyl-13-phenyl-1,8,11,13,14-pentazatetracyclo[8.7.0.02,7.012,16]heptadeca-2,4,6,10,12(16),14-hexaen-9-imine.
| Compound Name | N-(2,3-dimethylphenyl)-17-(2-fluorophenyl)-15-methyl-13-phenyl-1,8,11,13,14-pentazatetracyclo[8.7.0.02,7.012,16]heptadeca-2,4,6,10,12(16),14-hexaen-9-imine |
|---|---|
| PubChem CID | 135497782 |
| Molecular Formula | C33H27FN6 |
| Molecular Weight | 526.62 g/mol |
| Exact Mass | 526.23 |
| IUPAC Name | N-(2,3-dimethylphenyl)-17-(2-fluorophenyl)-15-methyl-13-phenyl-1,8,11,13,14-pentazatetracyclo[8.7.0.02,7.012,16]heptadeca-2,4,6,10,12(16),14-hexaen-9-imine |
| SMILES | Cc1cccc(/N=C2\Nc3ccccc3N3C2=Nc2c(c(C)nn2-c2ccccc2)C3c2ccccc2F)c1C |
| InChI | InChI=1S/C33H27FN6/c1-20-12-11-18-26(21(20)2)35-31-33-37-32-29(22(3)38-40(32)23-13-5-4-6-14-23)30(24-15-7-8-16-25(24)34)39(33)28-19-10-9-17-27(28)36-31/h4-19,30H,1-3H3,(H,35,36) |
| InChIKey | XTLOIXUZMMKQIV-UHFFFAOYSA-N |
| XLogP | 7.73 |
| TPSA | 57.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.62 |
| LogP ≤ 5 | 7.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|