C28H22N4O5S — CID 136899090
2-[(4R,7S)-3-methyl-4-(3-nitrophenyl)-5-oxo-7-thiophen-2-yl-6,7,8,9-tetrahydro-4H-pyrazolo[5,4-b]quinolin-1-yl]benzoic acid (PubChem CID 136899090) has the molecular formula C28H22N4O5S and a molecular weight of 526.57 g/mol. Its IUPAC name is 2-[(4R,7S)-3-methyl-4-(3-nitrophenyl)-5-oxo-7-thiophen-2-yl-6,7,8,9-tetrahydro-4H-pyrazolo[5,4-b]quinolin-1-yl]benzoic acid.
| Compound Name | 2-[(4R,7S)-3-methyl-4-(3-nitrophenyl)-5-oxo-7-thiophen-2-yl-6,7,8,9-tetrahydro-4H-pyrazolo[5,4-b]quinolin-1-yl]benzoic acid |
|---|---|
| PubChem CID | 136899090 |
| Molecular Formula | C28H22N4O5S |
| Molecular Weight | 526.57 g/mol |
| Exact Mass | 526.13 |
| IUPAC Name | 2-[(4R,7S)-3-methyl-4-(3-nitrophenyl)-5-oxo-7-thiophen-2-yl-6,7,8,9-tetrahydro-4H-pyrazolo[5,4-b]quinolin-1-yl]benzoic acid |
| SMILES | Cc1nn(-c2ccccc2C(=O)O)c2c1[C@@H](c1cccc([N+](=O)[O-])c1)C1=C(C[C@H](c3cccs3)CC1=O)N2 |
| InChI | InChI=1S/C28H22N4O5S/c1-15-24-25(16-6-4-7-18(12-16)32(36)37)26-20(13-17(14-22(26)33)23-10-5-11-38-23)29-27(24)31(30-15)21-9-3-2-8-19(21)28(34)35/h2-12,17,25,29H,13-14H2,1H3,(H,34,35)/t17-,25+/m0/s1 |
| InChIKey | FBANEWQEXNESHV-SSOJOUAXSA-N |
| XLogP | 5.81 |
| TPSA | 127.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.57 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|