C29H24N4O7S — CID 135906268
2-[4-(4-hydroxy-3-methoxy-5-nitrophenyl)-3-methyl-5-oxo-7-thiophen-2-yl-6,7,8,9-tetrahydro-4H-pyrazolo[5,4-b]quinolin-1-yl]benzoic acid (PubChem CID 135906268) has the molecular formula C29H24N4O7S and a molecular weight of 572.60 g/mol. Its IUPAC name is 2-[4-(4-hydroxy-3-methoxy-5-nitrophenyl)-3-methyl-5-oxo-7-thiophen-2-yl-6,7,8,9-tetrahydro-4H-pyrazolo[5,4-b]quinolin-1-yl]benzoic acid.
| Compound Name | 2-[4-(4-hydroxy-3-methoxy-5-nitrophenyl)-3-methyl-5-oxo-7-thiophen-2-yl-6,7,8,9-tetrahydro-4H-pyrazolo[5,4-b]quinolin-1-yl]benzoic acid |
|---|---|
| PubChem CID | 135906268 |
| Molecular Formula | C29H24N4O7S |
| Molecular Weight | 572.60 g/mol |
| Exact Mass | 572.14 |
| IUPAC Name | 2-[4-(4-hydroxy-3-methoxy-5-nitrophenyl)-3-methyl-5-oxo-7-thiophen-2-yl-6,7,8,9-tetrahydro-4H-pyrazolo[5,4-b]quinolin-1-yl]benzoic acid |
| SMILES | COc1cc(C2C3=C(CC(c4cccs4)CC3=O)Nc3c2c(C)nn3-c2ccccc2C(=O)O)cc([N+](=O)[O-])c1O |
| InChI | InChI=1S/C29H24N4O7S/c1-14-24-25(16-11-20(33(38)39)27(35)22(13-16)40-2)26-18(10-15(12-21(26)34)23-8-5-9-41-23)30-28(24)32(31-14)19-7-4-3-6-17(19)29(36)37/h3-9,11,13,15,25,30,35H,10,12H2,1-2H3,(H,36,37) |
| InChIKey | QUHQFHUWWOPDAP-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 156.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.60 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|