C30H28N2O8S — CID 3973785
2-phenoxyethyl 4-(4-hydroxy-3-methoxy-5-nitrophenyl)-2-methyl-5-oxo-7-thiophen-2-yl-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate (PubChem CID 3973785) has the molecular formula C30H28N2O8S and a molecular weight of 576.63 g/mol. Its IUPAC name is 2-phenoxyethyl 4-(4-hydroxy-3-methoxy-5-nitrophenyl)-2-methyl-5-oxo-7-thiophen-2-yl-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate.
| Compound Name | 2-phenoxyethyl 4-(4-hydroxy-3-methoxy-5-nitrophenyl)-2-methyl-5-oxo-7-thiophen-2-yl-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate |
|---|---|
| PubChem CID | 3973785 |
| Molecular Formula | C30H28N2O8S |
| Molecular Weight | 576.63 g/mol |
| Exact Mass | 576.16 |
| IUPAC Name | 2-phenoxyethyl 4-(4-hydroxy-3-methoxy-5-nitrophenyl)-2-methyl-5-oxo-7-thiophen-2-yl-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate |
| SMILES | COc1cc(C2C(C(=O)OCCOc3ccccc3)=C(C)NC3=C2C(=O)CC(c2cccs2)C3)cc([N+](=O)[O-])c1O |
| InChI | InChI=1S/C30H28N2O8S/c1-17-26(30(35)40-11-10-39-20-7-4-3-5-8-20)27(19-14-22(32(36)37)29(34)24(16-19)38-2)28-21(31-17)13-18(15-23(28)33)25-9-6-12-41-25/h3-9,12,14,16,18,27,31,34H,10-11,13,15H2,1-2H3 |
| InChIKey | XZRLNDZJAIVZRH-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 137.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.63 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|