C30H34N2O9 — CID 3693203
2-propan-2-yloxyethyl 4-(4-hydroxy-3-methoxy-5-nitrophenyl)-7-(2-methoxyphenyl)-2-methyl-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate (PubChem CID 3693203) has the molecular formula C30H34N2O9 and a molecular weight of 566.61 g/mol. Its IUPAC name is 2-propan-2-yloxyethyl 4-(4-hydroxy-3-methoxy-5-nitrophenyl)-7-(2-methoxyphenyl)-2-methyl-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate.
| Compound Name | 2-propan-2-yloxyethyl 4-(4-hydroxy-3-methoxy-5-nitrophenyl)-7-(2-methoxyphenyl)-2-methyl-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate |
|---|---|
| PubChem CID | 3693203 |
| Molecular Formula | C30H34N2O9 |
| Molecular Weight | 566.61 g/mol |
| Exact Mass | 566.23 |
| IUPAC Name | 2-propan-2-yloxyethyl 4-(4-hydroxy-3-methoxy-5-nitrophenyl)-7-(2-methoxyphenyl)-2-methyl-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate |
| SMILES | COc1ccccc1C1CC(=O)C2=C(C1)NC(C)=C(C(=O)OCCOC(C)C)C2c1cc(OC)c(O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C30H34N2O9/c1-16(2)40-10-11-41-30(35)26-17(3)31-21-12-18(20-8-6-7-9-24(20)38-4)14-23(33)28(21)27(26)19-13-22(32(36)37)29(34)25(15-19)39-5/h6-9,13,15-16,18,27,31,34H,10-12,14H2,1-5H3 |
| InChIKey | CBUKRHRSYAIWNM-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 146.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.61 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|