C29H26N2O7S — CID 92905996
benzyl (4R,7S)-4-(4-hydroxy-3-methoxy-5-nitrophenyl)-2-methyl-5-oxo-7-thiophen-2-yl-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate (PubChem CID 92905996) has the molecular formula C29H26N2O7S and a molecular weight of 546.60 g/mol. Its IUPAC name is benzyl (4R,7S)-4-(4-hydroxy-3-methoxy-5-nitrophenyl)-2-methyl-5-oxo-7-thiophen-2-yl-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate.
| Compound Name | benzyl (4R,7S)-4-(4-hydroxy-3-methoxy-5-nitrophenyl)-2-methyl-5-oxo-7-thiophen-2-yl-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate |
|---|---|
| PubChem CID | 92905996 |
| Molecular Formula | C29H26N2O7S |
| Molecular Weight | 546.60 g/mol |
| Exact Mass | 546.15 |
| IUPAC Name | benzyl (4R,7S)-4-(4-hydroxy-3-methoxy-5-nitrophenyl)-2-methyl-5-oxo-7-thiophen-2-yl-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate |
| SMILES | COc1cc([C@H]2C(C(=O)OCc3ccccc3)=C(C)NC3=C2C(=O)C[C@@H](c2cccs2)C3)cc([N+](=O)[O-])c1O |
| InChI | InChI=1S/C29H26N2O7S/c1-16-25(29(34)38-15-17-7-4-3-5-8-17)26(19-12-21(31(35)36)28(33)23(14-19)37-2)27-20(30-16)11-18(13-22(27)32)24-9-6-10-39-24/h3-10,12,14,18,26,30,33H,11,13,15H2,1-2H3/t18-,26-/m0/s1 |
| InChIKey | GMCUHKJVWDYORJ-QYBDOPJKSA-N |
| XLogP | 5.48 |
| TPSA | 128.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.60 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|