C30H27N3O5S — CID 136852624
2-[(4S,7R)-4-(2,3-dimethoxyphenyl)-3-methyl-5-oxo-7-thiophen-2-yl-6,7,8,9-tetrahydro-4H-pyrazolo[5,4-b]quinolin-1-yl]benzoic acid (PubChem CID 136852624) has the molecular formula C30H27N3O5S and a molecular weight of 541.63 g/mol. Its IUPAC name is 2-[(4S,7R)-4-(2,3-dimethoxyphenyl)-3-methyl-5-oxo-7-thiophen-2-yl-6,7,8,9-tetrahydro-4H-pyrazolo[5,4-b]quinolin-1-yl]benzoic acid.
| Compound Name | 2-[(4S,7R)-4-(2,3-dimethoxyphenyl)-3-methyl-5-oxo-7-thiophen-2-yl-6,7,8,9-tetrahydro-4H-pyrazolo[5,4-b]quinolin-1-yl]benzoic acid |
|---|---|
| PubChem CID | 136852624 |
| Molecular Formula | C30H27N3O5S |
| Molecular Weight | 541.63 g/mol |
| Exact Mass | 541.17 |
| IUPAC Name | 2-[(4S,7R)-4-(2,3-dimethoxyphenyl)-3-methyl-5-oxo-7-thiophen-2-yl-6,7,8,9-tetrahydro-4H-pyrazolo[5,4-b]quinolin-1-yl]benzoic acid |
| SMILES | COc1cccc([C@H]2C3=C(C[C@@H](c4cccs4)CC3=O)Nc3c2c(C)nn3-c2ccccc2C(=O)O)c1OC |
| InChI | InChI=1S/C30H27N3O5S/c1-16-25-26(19-9-6-11-23(37-2)28(19)38-3)27-20(14-17(15-22(27)34)24-12-7-13-39-24)31-29(25)33(32-16)21-10-5-4-8-18(21)30(35)36/h4-13,17,26,31H,14-15H2,1-3H3,(H,35,36)/t17-,26-/m1/s1 |
| InChIKey | YOLZAQSNKCHMEN-WGDIFIGCSA-N |
| XLogP | 5.92 |
| TPSA | 102.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.63 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |