C26H28N2O6S — CID 5194171
2-propan-2-yloxyethyl 2-methylidene-4-(3-nitrophenyl)-5-oxo-7-thiophen-2-yl-1,3,4,6,7,8-hexahydroquinoline-3-carboxylate (PubChem CID 5194171) has the molecular formula C26H28N2O6S and a molecular weight of 496.59 g/mol. Its IUPAC name is 2-propan-2-yloxyethyl 2-methylidene-4-(3-nitrophenyl)-5-oxo-7-thiophen-2-yl-1,3,4,6,7,8-hexahydroquinoline-3-carboxylate.
| Compound Name | 2-propan-2-yloxyethyl 2-methylidene-4-(3-nitrophenyl)-5-oxo-7-thiophen-2-yl-1,3,4,6,7,8-hexahydroquinoline-3-carboxylate |
|---|---|
| PubChem CID | 5194171 |
| Molecular Formula | C26H28N2O6S |
| Molecular Weight | 496.59 g/mol |
| Exact Mass | 496.17 |
| IUPAC Name | 2-propan-2-yloxyethyl 2-methylidene-4-(3-nitrophenyl)-5-oxo-7-thiophen-2-yl-1,3,4,6,7,8-hexahydroquinoline-3-carboxylate |
| SMILES | C=C1NC2=C(C(=O)CC(c3cccs3)C2)C(c2cccc([N+](=O)[O-])c2)C1C(=O)OCCOC(C)C |
| InChI | InChI=1S/C26H28N2O6S/c1-15(2)33-9-10-34-26(30)23-16(3)27-20-13-18(22-8-5-11-35-22)14-21(29)25(20)24(23)17-6-4-7-19(12-17)28(31)32/h4-8,11-12,15,18,23-24,27H,3,9-10,13-14H2,1-2H3 |
| InChIKey | PPDZVXHWGOZPCY-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 107.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.59 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|