C25H27NO4S — CID 3617839
propan-2-yl 4-(2-methoxyphenyl)-2-methylidene-5-oxo-7-thiophen-2-yl-1,3,4,6,7,8-hexahydroquinoline-3-carboxylate (PubChem CID 3617839) has the molecular formula C25H27NO4S and a molecular weight of 437.56 g/mol. Its IUPAC name is propan-2-yl 4-(2-methoxyphenyl)-2-methylidene-5-oxo-7-thiophen-2-yl-1,3,4,6,7,8-hexahydroquinoline-3-carboxylate.
| Compound Name | propan-2-yl 4-(2-methoxyphenyl)-2-methylidene-5-oxo-7-thiophen-2-yl-1,3,4,6,7,8-hexahydroquinoline-3-carboxylate |
|---|---|
| PubChem CID | 3617839 |
| Molecular Formula | C25H27NO4S |
| Molecular Weight | 437.56 g/mol |
| Exact Mass | 437.17 |
| IUPAC Name | propan-2-yl 4-(2-methoxyphenyl)-2-methylidene-5-oxo-7-thiophen-2-yl-1,3,4,6,7,8-hexahydroquinoline-3-carboxylate |
| SMILES | C=C1NC2=C(C(=O)CC(c3cccs3)C2)C(c2ccccc2OC)C1C(=O)OC(C)C |
| InChI | InChI=1S/C25H27NO4S/c1-14(2)30-25(28)22-15(3)26-18-12-16(21-10-7-11-31-21)13-19(27)24(18)23(22)17-8-5-6-9-20(17)29-4/h5-11,14,16,22-23,26H,3,12-13H2,1-2,4H3 |
| InChIKey | LJEZYEGINJBDTM-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.56 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |