C26H27NO3 — CID 4992029
propan-2-yl 2-methylidene-5-oxo-4,7-diphenyl-1,3,4,6,7,8-hexahydroquinoline-3-carboxylate (PubChem CID 4992029) has the molecular formula C26H27NO3 and a molecular weight of 401.51 g/mol. Its IUPAC name is propan-2-yl 2-methylidene-5-oxo-4,7-diphenyl-1,3,4,6,7,8-hexahydroquinoline-3-carboxylate.
| Compound Name | propan-2-yl 2-methylidene-5-oxo-4,7-diphenyl-1,3,4,6,7,8-hexahydroquinoline-3-carboxylate |
|---|---|
| PubChem CID | 4992029 |
| Molecular Formula | C26H27NO3 |
| Molecular Weight | 401.51 g/mol |
| Exact Mass | 401.20 |
| IUPAC Name | propan-2-yl 2-methylidene-5-oxo-4,7-diphenyl-1,3,4,6,7,8-hexahydroquinoline-3-carboxylate |
| SMILES | C=C1NC2=C(C(=O)CC(c3ccccc3)C2)C(c2ccccc2)C1C(=O)OC(C)C |
| InChI | InChI=1S/C26H27NO3/c1-16(2)30-26(29)23-17(3)27-21-14-20(18-10-6-4-7-11-18)15-22(28)25(21)24(23)19-12-8-5-9-13-19/h4-13,16,20,23-24,27H,3,14-15H2,1-2H3 |
| InChIKey | YJCGYXDBQABJIZ-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.51 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |