C32H33NO7S — CID 3372359
2-phenoxyethyl 2-methylidene-5-oxo-7-thiophen-2-yl-4-(3,4,5-trimethoxyphenyl)-1,3,4,6,7,8-hexahydroquinoline-3-carboxylate (PubChem CID 3372359) has the molecular formula C32H33NO7S and a molecular weight of 575.68 g/mol. Its IUPAC name is 2-phenoxyethyl 2-methylidene-5-oxo-7-thiophen-2-yl-4-(3,4,5-trimethoxyphenyl)-1,3,4,6,7,8-hexahydroquinoline-3-carboxylate.
| Compound Name | 2-phenoxyethyl 2-methylidene-5-oxo-7-thiophen-2-yl-4-(3,4,5-trimethoxyphenyl)-1,3,4,6,7,8-hexahydroquinoline-3-carboxylate |
|---|---|
| PubChem CID | 3372359 |
| Molecular Formula | C32H33NO7S |
| Molecular Weight | 575.68 g/mol |
| Exact Mass | 575.20 |
| IUPAC Name | 2-phenoxyethyl 2-methylidene-5-oxo-7-thiophen-2-yl-4-(3,4,5-trimethoxyphenyl)-1,3,4,6,7,8-hexahydroquinoline-3-carboxylate |
| SMILES | C=C1NC2=C(C(=O)CC(c3cccs3)C2)C(c2cc(OC)c(OC)c(OC)c2)C1C(=O)OCCOc1ccccc1 |
| InChI | InChI=1S/C32H33NO7S/c1-19-28(32(35)40-13-12-39-22-9-6-5-7-10-22)29(21-17-25(36-2)31(38-4)26(18-21)37-3)30-23(33-19)15-20(16-24(30)34)27-11-8-14-41-27/h5-11,14,17-18,20,28-29,33H,1,12-13,15-16H2,2-4H3 |
| InChIKey | UACVKHZAMYUTSZ-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 92.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.68 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|