C22H27N7O4 — CID 160717521
2,5-dimethylpyrazol-3-amine;methyl 1,3,6-trimethyl-4-(3-nitrophenyl)-4,7-dihydropyrazolo[5,4-b]pyridine-5-carboxylate (PubChem CID 160717521) has the molecular formula C22H27N7O4 and a molecular weight of 453.50 g/mol. Its IUPAC name is 2,5-dimethylpyrazol-3-amine;methyl 1,3,6-trimethyl-4-(3-nitrophenyl)-4,7-dihydropyrazolo[5,4-b]pyridine-5-carboxylate.
| Compound Name | 2,5-dimethylpyrazol-3-amine;methyl 1,3,6-trimethyl-4-(3-nitrophenyl)-4,7-dihydropyrazolo[5,4-b]pyridine-5-carboxylate |
|---|---|
| PubChem CID | 160717521 |
| Molecular Formula | C22H27N7O4 |
| Molecular Weight | 453.50 g/mol |
| Exact Mass | 453.21 |
| IUPAC Name | 2,5-dimethylpyrazol-3-amine;methyl 1,3,6-trimethyl-4-(3-nitrophenyl)-4,7-dihydropyrazolo[5,4-b]pyridine-5-carboxylate |
| SMILES | COC(=O)C1=C(C)Nc2c(c(C)nn2C)C1c1cccc([N+](=O)[O-])c1.Cc1cc(N)n(C)n1 |
| InChI | InChI=1S/C17H18N4O4.C5H9N3/c1-9-14(17(22)25-4)15(11-6-5-7-12(8-11)21(23)24)13-10(2)19-20(3)16(13)18-9;1-4-3-5(6)8(2)7-4/h5-8,15,18H,1-4H3;3H,6H2,1-2H3 |
| InChIKey | RSQZWSGDIGWFTL-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 143.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.50 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|