C22H26N4O4 — CID 135726301
3-cycloheptyl-1,6-dimethyl-4-(3-nitrophenyl)-4,7-dihydropyrazolo[5,4-b]pyridine-5-carboxylic acid (PubChem CID 135726301) has the molecular formula C22H26N4O4 and a molecular weight of 410.47 g/mol. Its IUPAC name is 3-cycloheptyl-1,6-dimethyl-4-(3-nitrophenyl)-4,7-dihydropyrazolo[5,4-b]pyridine-5-carboxylic acid.
| Compound Name | 3-cycloheptyl-1,6-dimethyl-4-(3-nitrophenyl)-4,7-dihydropyrazolo[5,4-b]pyridine-5-carboxylic acid |
|---|---|
| PubChem CID | 135726301 |
| Molecular Formula | C22H26N4O4 |
| Molecular Weight | 410.47 g/mol |
| Exact Mass | 410.20 |
| IUPAC Name | 3-cycloheptyl-1,6-dimethyl-4-(3-nitrophenyl)-4,7-dihydropyrazolo[5,4-b]pyridine-5-carboxylic acid |
| SMILES | CC1=C(C(=O)O)C(c2cccc([N+](=O)[O-])c2)c2c(C3CCCCCC3)nn(C)c2N1 |
| InChI | InChI=1S/C22H26N4O4/c1-13-17(22(27)28)18(15-10-7-11-16(12-15)26(29)30)19-20(24-25(2)21(19)23-13)14-8-5-3-4-6-9-14/h7,10-12,14,18,23H,3-6,8-9H2,1-2H3,(H,27,28) |
| InChIKey | FSRMERPHDOZJPL-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 110.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.47 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|