C22H15N3O4S — CID 156905714
12-(3-hydroxyphenyl)-15-oxa-5-thia-2,4,9-triazapentacyclo[11.8.0.03,11.04,8.016,21]henicosa-1(13),3(11),8,16,18,20-hexaene-10,14-dione (PubChem CID 156905714) has the molecular formula C22H15N3O4S and a molecular weight of 417.45 g/mol. Its IUPAC name is 12-(3-hydroxyphenyl)-15-oxa-5-thia-2,4,9-triazapentacyclo[11.8.0.03,11.04,8.016,21]henicosa-1(13),3(11),8,16,18,20-hexaene-10,14-dione.
| Compound Name | 12-(3-hydroxyphenyl)-15-oxa-5-thia-2,4,9-triazapentacyclo[11.8.0.03,11.04,8.016,21]henicosa-1(13),3(11),8,16,18,20-hexaene-10,14-dione |
|---|---|
| PubChem CID | 156905714 |
| Molecular Formula | C22H15N3O4S |
| Molecular Weight | 417.45 g/mol |
| Exact Mass | 417.08 |
| IUPAC Name | 12-(3-hydroxyphenyl)-15-oxa-5-thia-2,4,9-triazapentacyclo[11.8.0.03,11.04,8.016,21]henicosa-1(13),3(11),8,16,18,20-hexaene-10,14-dione |
| SMILES | O=c1nc2n(c3c1C(c1cccc(O)c1)c1c(c4ccccc4oc1=O)N3)SCC2 |
| InChI | InChI=1S/C22H15N3O4S/c26-12-5-3-4-11(10-12)16-17-19(13-6-1-2-7-14(13)29-22(17)28)24-20-18(16)21(27)23-15-8-9-30-25(15)20/h1-7,10,16,24,26H,8-9H2 |
| InChIKey | IKZSMUQFAANXLH-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 97.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.45 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|