C19H13N3O3 — CID 137085351
(11S)-11-(4-hydroxyphenyl)-8-oxa-14,15,17-triazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,12(16),13-hexaen-9-one (PubChem CID 137085351) has the molecular formula C19H13N3O3 and a molecular weight of 331.33 g/mol. Its IUPAC name is (11S)-11-(4-hydroxyphenyl)-8-oxa-14,15,17-triazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,12(16),13-hexaen-9-one.
| Compound Name | (11S)-11-(4-hydroxyphenyl)-8-oxa-14,15,17-triazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,12(16),13-hexaen-9-one |
|---|---|
| PubChem CID | 137085351 |
| Molecular Formula | C19H13N3O3 |
| Molecular Weight | 331.33 g/mol |
| Exact Mass | 331.10 |
| IUPAC Name | (11S)-11-(4-hydroxyphenyl)-8-oxa-14,15,17-triazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,12(16),13-hexaen-9-one |
| SMILES | O=c1oc2ccccc2c2c1[C@@H](c1ccc(O)cc1)c1cn[nH]c1N2 |
| InChI | InChI=1S/C19H13N3O3/c23-11-7-5-10(6-8-11)15-13-9-20-22-18(13)21-17-12-3-1-2-4-14(12)25-19(24)16(15)17/h1-9,15,23H,(H2,20,21,22)/t15-/m0/s1 |
| InChIKey | FJJIDXCIAKDPSV-HNNXBMFYSA-N |
| XLogP | 3.46 |
| TPSA | 91.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.33 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|