C19H11F2N3O2 — CID 137192278
11-(3,4-difluorophenyl)-8-oxa-14,15,17-triazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,12(16),13-hexaen-9-one (PubChem CID 137192278) has the molecular formula C19H11F2N3O2 and a molecular weight of 351.31 g/mol. Its IUPAC name is 11-(3,4-difluorophenyl)-8-oxa-14,15,17-triazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,12(16),13-hexaen-9-one.
| Compound Name | 11-(3,4-difluorophenyl)-8-oxa-14,15,17-triazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,12(16),13-hexaen-9-one |
|---|---|
| PubChem CID | 137192278 |
| Molecular Formula | C19H11F2N3O2 |
| Molecular Weight | 351.31 g/mol |
| Exact Mass | 351.08 |
| IUPAC Name | 11-(3,4-difluorophenyl)-8-oxa-14,15,17-triazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,12(16),13-hexaen-9-one |
| SMILES | O=c1oc2ccccc2c2c1C(c1ccc(F)c(F)c1)c1cn[nH]c1N2 |
| InChI | InChI=1S/C19H11F2N3O2/c20-12-6-5-9(7-13(12)21)15-11-8-22-24-18(11)23-17-10-3-1-2-4-14(10)26-19(25)16(15)17/h1-8,15H,(H2,22,23,24) |
| InChIKey | UEBOXLQEBYUPHE-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 70.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.31 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|