C19H13N3O2S — CID 11013464
4-(1H-indol-3-yl)-2-sulfanylidene-3,4-dihydro-1H-chromeno[4,3-d]pyrimidin-5-one (PubChem CID 11013464) has the molecular formula C19H13N3O2S and a molecular weight of 347.40 g/mol. Its IUPAC name is 4-(1H-indol-3-yl)-2-sulfanylidene-3,4-dihydro-1H-chromeno[4,3-d]pyrimidin-5-one.
| Compound Name | 4-(1H-indol-3-yl)-2-sulfanylidene-3,4-dihydro-1H-chromeno[4,3-d]pyrimidin-5-one |
|---|---|
| PubChem CID | 11013464 |
| Molecular Formula | C19H13N3O2S |
| Molecular Weight | 347.40 g/mol |
| Exact Mass | 347.07 |
| IUPAC Name | 4-(1H-indol-3-yl)-2-sulfanylidene-3,4-dihydro-1H-chromeno[4,3-d]pyrimidin-5-one |
| SMILES | O=c1oc2ccccc2c2c1C(c1c[nH]c3ccccc13)NC(=S)N2 |
| InChI | InChI=1S/C19H13N3O2S/c23-18-15-16(11-6-2-4-8-14(11)24-18)21-19(25)22-17(15)12-9-20-13-7-3-1-5-10(12)13/h1-9,17,20H,(H2,21,22,25) |
| InChIKey | DWRQWFHJMCINCY-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 70.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.40 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|