C16H12N2OS — CID 4794447
2-(1H-indol-3-yl)-4H-1,4-benzothiazin-3-one (PubChem CID 4794447) has the molecular formula C16H12N2OS and a molecular weight of 280.35 g/mol. Its IUPAC name is 2-(1H-indol-3-yl)-4H-1,4-benzothiazin-3-one.
| Compound Name | 2-(1H-indol-3-yl)-4H-1,4-benzothiazin-3-one |
|---|---|
| PubChem CID | 4794447 |
| Molecular Formula | C16H12N2OS |
| Molecular Weight | 280.35 g/mol |
| Exact Mass | 280.07 |
| IUPAC Name | 2-(1H-indol-3-yl)-4H-1,4-benzothiazin-3-one |
| SMILES | O=C1Nc2ccccc2SC1c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C16H12N2OS/c19-16-15(20-14-8-4-3-7-13(14)18-16)11-9-17-12-6-2-1-5-10(11)12/h1-9,15,17H,(H,18,19) |
| InChIKey | LBTRKEPIBWQMFZ-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.35 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |