C19H18ClN3OS — CID 2322293
(4R,4aS)-4-(2-chloroquinolin-3-yl)-7,7-dimethyl-2-sulfanylidene-3,4,4a,6-tetrahydro-1H-quinazolin-5-one (PubChem CID 2322293) has the molecular formula C19H18ClN3OS and a molecular weight of 371.89 g/mol. Its IUPAC name is (4R,4aS)-4-(2-chloroquinolin-3-yl)-7,7-dimethyl-2-sulfanylidene-3,4,4a,6-tetrahydro-1H-quinazolin-5-one.
| Compound Name | (4R,4aS)-4-(2-chloroquinolin-3-yl)-7,7-dimethyl-2-sulfanylidene-3,4,4a,6-tetrahydro-1H-quinazolin-5-one |
|---|---|
| PubChem CID | 2322293 |
| Molecular Formula | C19H18ClN3OS |
| Molecular Weight | 371.89 g/mol |
| Exact Mass | 371.09 |
| IUPAC Name | (4R,4aS)-4-(2-chloroquinolin-3-yl)-7,7-dimethyl-2-sulfanylidene-3,4,4a,6-tetrahydro-1H-quinazolin-5-one |
| SMILES | CC1(C)C=C2NC(=S)N[C@@H](c3cc4ccccc4nc3Cl)[C@@H]2C(=O)C1 |
| InChI | InChI=1S/C19H18ClN3OS/c1-19(2)8-13-15(14(24)9-19)16(23-18(25)22-13)11-7-10-5-3-4-6-12(10)21-17(11)20/h3-8,15-16H,9H2,1-2H3,(H2,22,23,25)/t15-,16-/m0/s1 |
| InChIKey | UXNYXVCLWUZEAY-HOTGVXAUSA-N |
| XLogP | 3.91 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.89 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|