C17H12O2 — CID 58280677
7,8-dihydrobenzo[b]xanthen-12-one (PubChem CID 58280677) has the molecular formula C17H12O2 and a molecular weight of 248.28 g/mol. Its IUPAC name is 7,8-dihydrobenzo[b]xanthen-12-one.
| Compound Name | 7,8-dihydrobenzo[b]xanthen-12-one |
|---|---|
| PubChem CID | 58280677 |
| Molecular Formula | C17H12O2 |
| Molecular Weight | 248.28 g/mol |
| Exact Mass | 248.08 |
| IUPAC Name | 7,8-dihydrobenzo[b]xanthen-12-one |
| SMILES | O=c1c2ccccc2oc2cc3c(cc12)C=CCC3 |
| InChI | InChI=1S/C17H12O2/c18-17-13-7-3-4-8-15(13)19-16-10-12-6-2-1-5-11(12)9-14(16)17/h1,3-5,7-10H,2,6H2 |
| InChIKey | JAPKFQNZVHGRTQ-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 30.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.28 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|