C8H6O3 — CID 22994886
1-benzofuran-2,3-diol (PubChem CID 22994886) has the molecular formula C8H6O3 and a molecular weight of 150.13 g/mol. Its IUPAC name is 1-benzofuran-2,3-diol.
| Compound Name | 1-benzofuran-2,3-diol |
|---|---|
| PubChem CID | 22994886 |
| Molecular Formula | C8H6O3 |
| Molecular Weight | 150.13 g/mol |
| Exact Mass | 150.03 |
| IUPAC Name | 1-benzofuran-2,3-diol |
| SMILES | Oc1oc2ccccc2c1O |
| InChI | InChI=1S/C8H6O3/c9-7-5-3-1-2-4-6(5)11-8(7)10/h1-4,9-10H |
| InChIKey | DNDWXJDUTDZBNV-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.13 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |