C18H13NO2 — CID 164681985
2-methylidene-1-phenyl-3H-chromeno[4,3-b]pyrrol-4-one (PubChem CID 164681985) has the molecular formula C18H13NO2 and a molecular weight of 275.31 g/mol. Its IUPAC name is 2-methylidene-1-phenyl-3H-chromeno[4,3-b]pyrrol-4-one.
| Compound Name | 2-methylidene-1-phenyl-3H-chromeno[4,3-b]pyrrol-4-one |
|---|---|
| PubChem CID | 164681985 |
| Molecular Formula | C18H13NO2 |
| Molecular Weight | 275.31 g/mol |
| Exact Mass | 275.09 |
| IUPAC Name | 2-methylidene-1-phenyl-3H-chromeno[4,3-b]pyrrol-4-one |
| SMILES | C=C1Cc2c(c3ccccc3oc2=O)N1c1ccccc1 |
| InChI | InChI=1S/C18H13NO2/c1-12-11-15-17(19(12)13-7-3-2-4-8-13)14-9-5-6-10-16(14)21-18(15)20/h2-10H,1,11H2 |
| InChIKey | SNNFEBSPVMENIT-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 33.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.31 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|