C18H16O2 — CID 16754820
12-methyl-1,2,3,4-tetrahydronaphtho[1,2-c]chromen-5-one (PubChem CID 16754820) has the molecular formula C18H16O2 and a molecular weight of 264.32 g/mol. Its IUPAC name is 12-methyl-1,2,3,4-tetrahydronaphtho[1,2-c]chromen-5-one.
| Compound Name | 12-methyl-1,2,3,4-tetrahydronaphtho[1,2-c]chromen-5-one |
|---|---|
| PubChem CID | 16754820 |
| Molecular Formula | C18H16O2 |
| Molecular Weight | 264.32 g/mol |
| Exact Mass | 264.12 |
| IUPAC Name | 12-methyl-1,2,3,4-tetrahydronaphtho[1,2-c]chromen-5-one |
| SMILES | Cc1cc2c(c3c1CCCC3)c(=O)oc1ccccc12 |
| InChI | InChI=1S/C18H16O2/c1-11-10-15-13-7-4-5-9-16(13)20-18(19)17(15)14-8-3-2-6-12(11)14/h4-5,7,9-10H,2-3,6,8H2,1H3 |
| InChIKey | CVEPWRWOQYVUAN-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 30.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.32 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|