C17H12O2S — CID 1235172
(2S)-2-phenyl-1,2-dihydrothieno[2,3-c]chromen-4-one (PubChem CID 1235172) has the molecular formula C17H12O2S and a molecular weight of 280.35 g/mol. Its IUPAC name is (2S)-2-phenyl-1,2-dihydrothieno[2,3-c]chromen-4-one.
| Compound Name | (2S)-2-phenyl-1,2-dihydrothieno[2,3-c]chromen-4-one |
|---|---|
| PubChem CID | 1235172 |
| Molecular Formula | C17H12O2S |
| Molecular Weight | 280.35 g/mol |
| Exact Mass | 280.06 |
| IUPAC Name | (2S)-2-phenyl-1,2-dihydrothieno[2,3-c]chromen-4-one |
| SMILES | O=c1oc2ccccc2c2c1S[C@H](c1ccccc1)C2 |
| InChI | InChI=1S/C17H12O2S/c18-17-16-13(12-8-4-5-9-14(12)19-17)10-15(20-16)11-6-2-1-3-7-11/h1-9,15H,10H2/t15-/m0/s1 |
| InChIKey | GXNFRHRTUKMVEM-HNNXBMFYSA-N |
| XLogP | 4.18 |
| TPSA | 30.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.35 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|