C18H11NO3 — CID 102451654
(2S,3S)-4-oxo-3-phenyl-2,3-dihydrofuro[3,2-c]chromene-2-carbonitrile (PubChem CID 102451654) has the molecular formula C18H11NO3 and a molecular weight of 289.29 g/mol. Its IUPAC name is (2S,3S)-4-oxo-3-phenyl-2,3-dihydrofuro[3,2-c]chromene-2-carbonitrile.
| Compound Name | (2S,3S)-4-oxo-3-phenyl-2,3-dihydrofuro[3,2-c]chromene-2-carbonitrile |
|---|---|
| PubChem CID | 102451654 |
| Molecular Formula | C18H11NO3 |
| Molecular Weight | 289.29 g/mol |
| Exact Mass | 289.07 |
| IUPAC Name | (2S,3S)-4-oxo-3-phenyl-2,3-dihydrofuro[3,2-c]chromene-2-carbonitrile |
| SMILES | N#C[C@H]1Oc2c(c(=O)oc3ccccc23)[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C18H11NO3/c19-10-14-15(11-6-2-1-3-7-11)16-17(21-14)12-8-4-5-9-13(12)22-18(16)20/h1-9,14-15H/t14-,15-/m1/s1 |
| InChIKey | GHLIPAKEZPDBKA-HUUCEWRRSA-N |
| XLogP | 3.21 |
| TPSA | 63.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.29 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|