C22H16O5 — CID 101123904
(7R,11aR)-7-phenyl-7a,9,10,11a-tetrahydro-7H-chromeno[3,2-c]chromene-6,8,11-trione (PubChem CID 101123904) has the molecular formula C22H16O5 and a molecular weight of 360.37 g/mol. Its IUPAC name is (7R,11aR)-7-phenyl-7a,9,10,11a-tetrahydro-7H-chromeno[3,2-c]chromene-6,8,11-trione.
| Compound Name | (7R,11aR)-7-phenyl-7a,9,10,11a-tetrahydro-7H-chromeno[3,2-c]chromene-6,8,11-trione |
|---|---|
| PubChem CID | 101123904 |
| Molecular Formula | C22H16O5 |
| Molecular Weight | 360.37 g/mol |
| Exact Mass | 360.10 |
| IUPAC Name | (7R,11aR)-7-phenyl-7a,9,10,11a-tetrahydro-7H-chromeno[3,2-c]chromene-6,8,11-trione |
| SMILES | O=C1CCC(=O)[C@@H]2Oc3c(c(=O)oc4ccccc34)[C@@H](c3ccccc3)C12 |
| InChI | InChI=1S/C22H16O5/c23-14-10-11-15(24)21-18(14)17(12-6-2-1-3-7-12)19-20(27-21)13-8-4-5-9-16(13)26-22(19)25/h1-9,17-18,21H,10-11H2/t17-,18?,21-/m0/s1 |
| InChIKey | SIUBBDCKJQMCEH-XBZLUXOVSA-N |
| XLogP | 3.23 |
| TPSA | 73.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.37 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|