C13H11IO3 — CID 101399806
2-(iodomethyl)-1-methyl-1,2-dihydrofuro[2,3-c]chromen-4-one (PubChem CID 101399806) has the molecular formula C13H11IO3 and a molecular weight of 342.13 g/mol. Its IUPAC name is 2-(iodomethyl)-1-methyl-1,2-dihydrofuro[2,3-c]chromen-4-one.
| Compound Name | 2-(iodomethyl)-1-methyl-1,2-dihydrofuro[2,3-c]chromen-4-one |
|---|---|
| PubChem CID | 101399806 |
| Molecular Formula | C13H11IO3 |
| Molecular Weight | 342.13 g/mol |
| Exact Mass | 341.98 |
| IUPAC Name | 2-(iodomethyl)-1-methyl-1,2-dihydrofuro[2,3-c]chromen-4-one |
| SMILES | CC1c2c(c(=O)oc3ccccc23)OC1CI |
| InChI | InChI=1S/C13H11IO3/c1-7-10(6-14)16-12-11(7)8-4-2-3-5-9(8)17-13(12)15/h2-5,7,10H,6H2,1H3 |
| InChIKey | WLGSWIGUOURYMD-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.13 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|