C19H13ClO4 — CID 15417282
(1R,14R)-17-chloro-9,12,21-trioxapentacyclo[12.8.0.02,11.03,8.015,20]docosa-2(11),3,5,7,15(20),16,18-heptaen-10-one (PubChem CID 15417282) has the molecular formula C19H13ClO4 and a molecular weight of 340.76 g/mol. Its IUPAC name is (1R,14R)-17-chloro-9,12,21-trioxapentacyclo[12.8.0.02,11.03,8.015,20]docosa-2(11),3,5,7,15(20),16,18-heptaen-10-one.
| Compound Name | (1R,14R)-17-chloro-9,12,21-trioxapentacyclo[12.8.0.02,11.03,8.015,20]docosa-2(11),3,5,7,15(20),16,18-heptaen-10-one |
|---|---|
| PubChem CID | 15417282 |
| Molecular Formula | C19H13ClO4 |
| Molecular Weight | 340.76 g/mol |
| Exact Mass | 340.05 |
| IUPAC Name | (1R,14R)-17-chloro-9,12,21-trioxapentacyclo[12.8.0.02,11.03,8.015,20]docosa-2(11),3,5,7,15(20),16,18-heptaen-10-one |
| SMILES | O=c1oc2ccccc2c2c1OC[C@H]1c3cc(Cl)ccc3OC[C@@H]21 |
| InChI | InChI=1S/C19H13ClO4/c20-10-5-6-15-12(7-10)13-8-23-18-17(14(13)9-22-15)11-3-1-2-4-16(11)24-19(18)21/h1-7,13-14H,8-9H2/t13-,14+/m0/s1 |
| InChIKey | DFZGQCVVEYTGEP-UONOGXRCSA-N |
| XLogP | 4.10 |
| TPSA | 48.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.76 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|