C19H13ClO4 — CID 10831062
3-benzoyl-9-chloro-3,4-dihydro-2H-pyrano[3,2-c]chromen-5-one (PubChem CID 10831062) has the molecular formula C19H13ClO4 and a molecular weight of 340.76 g/mol. Its IUPAC name is 3-benzoyl-9-chloro-3,4-dihydro-2H-pyrano[3,2-c]chromen-5-one.
| Compound Name | 3-benzoyl-9-chloro-3,4-dihydro-2H-pyrano[3,2-c]chromen-5-one |
|---|---|
| PubChem CID | 10831062 |
| Molecular Formula | C19H13ClO4 |
| Molecular Weight | 340.76 g/mol |
| Exact Mass | 340.05 |
| IUPAC Name | 3-benzoyl-9-chloro-3,4-dihydro-2H-pyrano[3,2-c]chromen-5-one |
| SMILES | O=C(c1ccccc1)C1COc2c(c(=O)oc3ccc(Cl)cc23)C1 |
| InChI | InChI=1S/C19H13ClO4/c20-13-6-7-16-14(9-13)18-15(19(22)24-16)8-12(10-23-18)17(21)11-4-2-1-3-5-11/h1-7,9,12H,8,10H2 |
| InChIKey | LSPDBRRIJNNPMX-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 56.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.76 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|