C16H11ClN2O3 — CID 19661939
3-benzamido-5-chloro-1-benzofuran-2-carboxamide (PubChem CID 19661939) has the molecular formula C16H11ClN2O3 and a molecular weight of 314.73 g/mol. Its IUPAC name is 3-benzamido-5-chloro-1-benzofuran-2-carboxamide.
| Compound Name | 3-benzamido-5-chloro-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 19661939 |
| Molecular Formula | C16H11ClN2O3 |
| Molecular Weight | 314.73 g/mol |
| Exact Mass | 314.05 |
| IUPAC Name | 3-benzamido-5-chloro-1-benzofuran-2-carboxamide |
| SMILES | NC(=O)c1oc2ccc(Cl)cc2c1NC(=O)c1ccccc1 |
| InChI | InChI=1S/C16H11ClN2O3/c17-10-6-7-12-11(8-10)13(14(22-12)15(18)20)19-16(21)9-4-2-1-3-5-9/h1-8H,(H2,18,20)(H,19,21) |
| InChIKey | NDUNLCKGYJWEQX-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 85.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.73 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |