C24H26ClNO4 — CID 175774067
5-chloro-3-[(3,5-ditert-butylbenzoyl)amino]-1-benzofuran-2-carboxylic acid (PubChem CID 175774067) has the molecular formula C24H26ClNO4 and a molecular weight of 427.93 g/mol. Its IUPAC name is 5-chloro-3-[(3,5-ditert-butylbenzoyl)amino]-1-benzofuran-2-carboxylic acid.
| Compound Name | 5-chloro-3-[(3,5-ditert-butylbenzoyl)amino]-1-benzofuran-2-carboxylic acid |
|---|---|
| PubChem CID | 175774067 |
| Molecular Formula | C24H26ClNO4 |
| Molecular Weight | 427.93 g/mol |
| Exact Mass | 427.16 |
| IUPAC Name | 5-chloro-3-[(3,5-ditert-butylbenzoyl)amino]-1-benzofuran-2-carboxylic acid |
| SMILES | CC(C)(C)c1cc(C(=O)Nc2c(C(=O)O)oc3ccc(Cl)cc23)cc(C(C)(C)C)c1 |
| InChI | InChI=1S/C24H26ClNO4/c1-23(2,3)14-9-13(10-15(11-14)24(4,5)6)21(27)26-19-17-12-16(25)7-8-18(17)30-20(19)22(28)29/h7-12H,1-6H3,(H,26,27)(H,28,29) |
| InChIKey | MEHWEYOHUSVXDH-UHFFFAOYSA-N |
| XLogP | 6.63 |
| TPSA | 79.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.93 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |