C11H7ClNO4- — CID 6949708
3-acetamido-5-chloro-1-benzofuran-2-carboxylate (PubChem CID 6949708) has the molecular formula C11H7ClNO4- and a molecular weight of 252.63 g/mol. Its IUPAC name is 3-acetamido-5-chloro-1-benzofuran-2-carboxylate.
| Compound Name | 3-acetamido-5-chloro-1-benzofuran-2-carboxylate |
|---|---|
| PubChem CID | 6949708 |
| Molecular Formula | C11H7ClNO4- |
| Molecular Weight | 252.63 g/mol |
| Exact Mass | 252.01 |
| IUPAC Name | 3-acetamido-5-chloro-1-benzofuran-2-carboxylate |
| SMILES | CC(=O)Nc1c(C(=O)[O-])oc2ccc(Cl)cc12 |
| InChI | InChI=1S/C11H8ClNO4/c1-5(14)13-9-7-4-6(12)2-3-8(7)17-10(9)11(15)16/h2-4H,1H3,(H,13,14)(H,15,16)/p-1 |
| InChIKey | WDSQIXUDTWCQJO-UHFFFAOYSA-M |
| XLogP | 1.41 |
| TPSA | 82.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.63 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |