C13H12BrNO4 — CID 757717
ethyl 3-acetamido-5-bromo-1-benzofuran-2-carboxylate (PubChem CID 757717) has the molecular formula C13H12BrNO4 and a molecular weight of 326.15 g/mol. Its IUPAC name is ethyl 3-acetamido-5-bromo-1-benzofuran-2-carboxylate.
| Compound Name | ethyl 3-acetamido-5-bromo-1-benzofuran-2-carboxylate |
|---|---|
| PubChem CID | 757717 |
| Molecular Formula | C13H12BrNO4 |
| Molecular Weight | 326.15 g/mol |
| Exact Mass | 324.99 |
| IUPAC Name | ethyl 3-acetamido-5-bromo-1-benzofuran-2-carboxylate |
| SMILES | CCOC(=O)c1oc2ccc(Br)cc2c1NC(C)=O |
| InChI | InChI=1S/C13H12BrNO4/c1-3-18-13(17)12-11(15-7(2)16)9-6-8(14)4-5-10(9)19-12/h4-6H,3H2,1-2H3,(H,15,16) |
| InChIKey | HZWOVONKBRHZSO-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.15 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |