C20H21BrNO3+ — CID 8897645
(5-bromo-2-ethoxycarbonyl-1-benzofuran-3-yl)methyl-[(1R)-1-phenylethyl]azanium (PubChem CID 8897645) has the molecular formula C20H21BrNO3+ and a molecular weight of 403.30 g/mol. Its IUPAC name is (5-bromo-2-ethoxycarbonyl-1-benzofuran-3-yl)methyl-[(1R)-1-phenylethyl]azanium.
| Compound Name | (5-bromo-2-ethoxycarbonyl-1-benzofuran-3-yl)methyl-[(1R)-1-phenylethyl]azanium |
|---|---|
| PubChem CID | 8897645 |
| Molecular Formula | C20H21BrNO3+ |
| Molecular Weight | 403.30 g/mol |
| Exact Mass | 402.07 |
| IUPAC Name | (5-bromo-2-ethoxycarbonyl-1-benzofuran-3-yl)methyl-[(1R)-1-phenylethyl]azanium |
| SMILES | CCOC(=O)c1oc2ccc(Br)cc2c1C[NH2+][C@H](C)c1ccccc1 |
| InChI | InChI=1S/C20H20BrNO3/c1-3-24-20(23)19-17(16-11-15(21)9-10-18(16)25-19)12-22-13(2)14-7-5-4-6-8-14/h4-11,13,22H,3,12H2,1-2H3/p+1/t13-/m1/s1 |
| InChIKey | APFPAASWRQJLGY-CYBMUJFWSA-O |
| XLogP | 4.20 |
| TPSA | 56.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.30 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |