C14H15BrN2O3S — CID 8776317
ethyl 5-bromo-3-[(N'-methylcarbamimidoyl)sulfanylmethyl]-1-benzofuran-2-carboxylate (PubChem CID 8776317) has the molecular formula C14H15BrN2O3S and a molecular weight of 371.26 g/mol. Its IUPAC name is ethyl 5-bromo-3-[(N'-methylcarbamimidoyl)sulfanylmethyl]-1-benzofuran-2-carboxylate.
| Compound Name | ethyl 5-bromo-3-[(N'-methylcarbamimidoyl)sulfanylmethyl]-1-benzofuran-2-carboxylate |
|---|---|
| PubChem CID | 8776317 |
| Molecular Formula | C14H15BrN2O3S |
| Molecular Weight | 371.26 g/mol |
| Exact Mass | 370.00 |
| IUPAC Name | ethyl 5-bromo-3-[(N'-methylcarbamimidoyl)sulfanylmethyl]-1-benzofuran-2-carboxylate |
| SMILES | CCOC(=O)c1oc2ccc(Br)cc2c1CS/C(N)=N/C |
| InChI | InChI=1S/C14H15BrN2O3S/c1-3-19-13(18)12-10(7-21-14(16)17-2)9-6-8(15)4-5-11(9)20-12/h4-6H,3,7H2,1-2H3,(H2,16,17) |
| InChIKey | GPHRYQHQJSKXEM-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 77.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.26 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|